C20H33NO — CID 123497107
6-imino-2,7,9-trimethyl-1-(3-propylidenecyclobutylidene)decan-5-one (PubChem CID 123497107) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is 6-imino-2,7,9-trimethyl-1-(3-propylidenecyclobutylidene)decan-5-one.
| Compound Name | 6-imino-2,7,9-trimethyl-1-(3-propylidenecyclobutylidene)decan-5-one |
|---|---|
| PubChem CID | 123497107 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | 6-imino-2,7,9-trimethyl-1-(3-propylidenecyclobutylidene)decan-5-one |
| SMILES | [H]/N=C(/C(=O)CCC(C)C=C1CC(=CCC)C1)C(C)CC(C)C |
| InChI | InChI=1S/C20H33NO/c1-6-7-17-12-18(13-17)11-15(4)8-9-19(22)20(21)16(5)10-14(2)3/h7,11,14-16,21H,6,8-10,12-13H2,1-5H3/b17-7-,18-11+,21-20+ |
| InChIKey | HSOIBIIHXNQGKX-BAKKHLIHSA-N |
| XLogP | 5.73 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|