C24H41NO — CID 143857915
1-[7-ethyl-5-(2-ethyl-4-imino-1-methylcyclohex-2-en-1-yl)-2,6-dimethylcyclononyl]ethanone (PubChem CID 143857915) has the molecular formula C24H41NO and a molecular weight of 359.60 g/mol. Its IUPAC name is 1-[7-ethyl-5-(2-ethyl-4-imino-1-methylcyclohex-2-en-1-yl)-2,6-dimethylcyclononyl]ethanone.
| Compound Name | 1-[7-ethyl-5-(2-ethyl-4-imino-1-methylcyclohex-2-en-1-yl)-2,6-dimethylcyclononyl]ethanone |
|---|---|
| PubChem CID | 143857915 |
| Molecular Formula | C24H41NO |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 359.32 |
| IUPAC Name | 1-[7-ethyl-5-(2-ethyl-4-imino-1-methylcyclohex-2-en-1-yl)-2,6-dimethylcyclononyl]ethanone |
| SMILES | [H]/N=C1/C=C(CC)C(C)(C2CCC(C)C(C(C)=O)CCC(CC)C2C)CC1 |
| InChI | InChI=1S/C24H41NO/c1-7-19-10-11-22(18(5)26)16(3)9-12-23(17(19)4)24(6)14-13-21(25)15-20(24)8-2/h15-17,19,22-23,25H,7-14H2,1-6H3/b25-21+ |
| InChIKey | OOEPIIPFFFNFNM-NJNXFGOHSA-N |
| XLogP | 6.84 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|