C18H31NO2 — CID 91000485
10-ethanimidoyl-3,7,11,11-tetramethyldodec-7-ene-2,9-dione (PubChem CID 91000485) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is 10-ethanimidoyl-3,7,11,11-tetramethyldodec-7-ene-2,9-dione.
| Compound Name | 10-ethanimidoyl-3,7,11,11-tetramethyldodec-7-ene-2,9-dione |
|---|---|
| PubChem CID | 91000485 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 10-ethanimidoyl-3,7,11,11-tetramethyldodec-7-ene-2,9-dione |
| SMILES | [H]/N=C(\C)C(C(=O)C=C(C)CCCC(C)C(C)=O)C(C)(C)C |
| InChI | InChI=1S/C18H31NO2/c1-12(9-8-10-13(2)15(4)20)11-16(21)17(14(3)19)18(5,6)7/h11,13,17,19H,8-10H2,1-7H3/b12-11?,19-14+ |
| InChIKey | GLGKMLZEJCHGNW-LQAGCJQGSA-N |
| XLogP | 4.60 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|