C22H35NO2 — CID 91045740
1-(1,2,3,4,4a,5,6,9,10,10a-decahydrobenzo[8]annulen-7-yl)-6-imino-7,7-dimethyloctane-1,5-dione (PubChem CID 91045740) has the molecular formula C22H35NO2 and a molecular weight of 345.53 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,9,10,10a-decahydrobenzo[8]annulen-7-yl)-6-imino-7,7-dimethyloctane-1,5-dione.
| Compound Name | 1-(1,2,3,4,4a,5,6,9,10,10a-decahydrobenzo[8]annulen-7-yl)-6-imino-7,7-dimethyloctane-1,5-dione |
|---|---|
| PubChem CID | 91045740 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,9,10,10a-decahydrobenzo[8]annulen-7-yl)-6-imino-7,7-dimethyloctane-1,5-dione |
| SMILES | [H]/N=C(/C(=O)CCCC(=O)C1=CCCC2CCCCC2CC1)C(C)(C)C |
| InChI | InChI=1S/C22H35NO2/c1-22(2,3)21(23)20(25)13-7-12-19(24)18-11-6-10-16-8-4-5-9-17(16)14-15-18/h11,16-17,23H,4-10,12-15H2,1-3H3/b18-11?,23-21- |
| InChIKey | HKJNDFAJGJXYDK-DMLOCMGESA-N |
| XLogP | 5.67 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|