C26H41NO2 — CID 91195423
(E)-1-(2,3,4,4a,5,6,7,8,9,10,11,11a-dodecahydro-1H-benzo[9]annulen-8-yl)-5-cycloheptyl-5-imino-3-methylpent-2-ene-1,4-dione (PubChem CID 91195423) has the molecular formula C26H41NO2 and a molecular weight of 399.62 g/mol. Its IUPAC name is (E)-1-(2,3,4,4a,5,6,7,8,9,10,11,11a-dodecahydro-1H-benzo[9]annulen-8-yl)-5-cycloheptyl-5-imino-3-methylpent-2-ene-1,4-dione.
| Compound Name | (E)-1-(2,3,4,4a,5,6,7,8,9,10,11,11a-dodecahydro-1H-benzo[9]annulen-8-yl)-5-cycloheptyl-5-imino-3-methylpent-2-ene-1,4-dione |
|---|---|
| PubChem CID | 91195423 |
| Molecular Formula | C26H41NO2 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.31 |
| IUPAC Name | (E)-1-(2,3,4,4a,5,6,7,8,9,10,11,11a-dodecahydro-1H-benzo[9]annulen-8-yl)-5-cycloheptyl-5-imino-3-methylpent-2-ene-1,4-dione |
| SMILES | [H]/N=C(/C(=O)/C(C)=C/C(=O)C1CCCC2CCCCC2CCC1)C1CCCCCC1 |
| InChI | InChI=1S/C26H41NO2/c1-19(26(29)25(27)23-12-4-2-3-5-13-23)18-24(28)22-16-8-14-20-10-6-7-11-21(20)15-9-17-22/h18,20-23,27H,2-17H2,1H3/b19-18+,27-25+ |
| InChIKey | XYLNYJOZWIBWOI-ZSVMZQBZSA-N |
| XLogP | 6.84 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|