C20H33NO2 — CID 123665049
2-imino-6,10-dimethyl-4-(2-methylhex-4-enyl)undec-4-ene-3,8-dione (PubChem CID 123665049) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is 2-imino-6,10-dimethyl-4-(2-methylhex-4-enyl)undec-4-ene-3,8-dione.
| Compound Name | 2-imino-6,10-dimethyl-4-(2-methylhex-4-enyl)undec-4-ene-3,8-dione |
|---|---|
| PubChem CID | 123665049 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | 2-imino-6,10-dimethyl-4-(2-methylhex-4-enyl)undec-4-ene-3,8-dione |
| SMILES | [H]/N=C(\C)C(=O)C(=CC(C)CC(=O)CC(C)C)CC(C)CC=CC |
| InChI | InChI=1S/C20H33NO2/c1-7-8-9-15(4)11-18(20(23)17(6)21)12-16(5)13-19(22)10-14(2)3/h7-8,12,14-16,21H,9-11,13H2,1-6H3/b8-7?,18-12?,21-17+ |
| InChIKey | ZAZODGDZQBYRFX-SOIIXKNASA-N |
| XLogP | 5.16 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|