C20H33NO2 — CID 91076788
5-ethanimidoyl-2,6,6-trimethyl-1-[1-methyl-2-(3-oxobutan-2-yl)cyclopropyl]hept-2-en-4-one (PubChem CID 91076788) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is 5-ethanimidoyl-2,6,6-trimethyl-1-[1-methyl-2-(3-oxobutan-2-yl)cyclopropyl]hept-2-en-4-one.
| Compound Name | 5-ethanimidoyl-2,6,6-trimethyl-1-[1-methyl-2-(3-oxobutan-2-yl)cyclopropyl]hept-2-en-4-one |
|---|---|
| PubChem CID | 91076788 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | 5-ethanimidoyl-2,6,6-trimethyl-1-[1-methyl-2-(3-oxobutan-2-yl)cyclopropyl]hept-2-en-4-one |
| SMILES | [H]/N=C(\C)C(C(=O)C=C(C)CC1(C)CC1C(C)C(C)=O)C(C)(C)C |
| InChI | InChI=1S/C20H33NO2/c1-12(9-17(23)18(14(3)21)19(5,6)7)10-20(8)11-16(20)13(2)15(4)22/h9,13,16,18,21H,10-11H2,1-8H3/b12-9?,21-14+ |
| InChIKey | WPMZYWVZPSIFNS-RWKGHWKISA-N |
| XLogP | 4.85 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|