C16H25NO — CID 163456522
4-imino-2,5,6-trimethyl-3-[(E)-3-methylhex-2-enyl]cyclohex-2-en-1-one (PubChem CID 163456522) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is 4-imino-2,5,6-trimethyl-3-[(E)-3-methylhex-2-enyl]cyclohex-2-en-1-one.
| Compound Name | 4-imino-2,5,6-trimethyl-3-[(E)-3-methylhex-2-enyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 163456522 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 4-imino-2,5,6-trimethyl-3-[(E)-3-methylhex-2-enyl]cyclohex-2-en-1-one |
| SMILES | [H]/N=C1/C(C/C=C(\C)CCC)=C(C)C(=O)C(C)C1C |
| InChI | InChI=1S/C16H25NO/c1-6-7-10(2)8-9-14-13(5)16(18)12(4)11(3)15(14)17/h8,11-12,17H,6-7,9H2,1-5H3/b10-8+,17-15+ |
| InChIKey | BKZCKIPGANAZKX-ARBZGMGISA-N |
| XLogP | 4.31 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|