C22H29NO — CID 90711489
3-imino-5,5-dimethyl-2-(3,6,7-trimethylideneundeca-4,8,10-trien-2-yl)cyclohexan-1-one (PubChem CID 90711489) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is 3-imino-5,5-dimethyl-2-(3,6,7-trimethylideneundeca-4,8,10-trien-2-yl)cyclohexan-1-one.
| Compound Name | 3-imino-5,5-dimethyl-2-(3,6,7-trimethylideneundeca-4,8,10-trien-2-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 90711489 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 3-imino-5,5-dimethyl-2-(3,6,7-trimethylideneundeca-4,8,10-trien-2-yl)cyclohexan-1-one |
| SMILES | [H]/N=C1\CC(C)(C)CC(=O)C1C(C)C(=C)C=CC(=C)C(=C)C=CC=C |
| InChI | InChI=1S/C22H29NO/c1-8-9-10-15(2)16(3)11-12-17(4)18(5)21-19(23)13-22(6,7)14-20(21)24/h8-12,18,21,23H,1-4,13-14H2,5-7H3/b10-9?,12-11?,23-19+ |
| InChIKey | AXIYIOJRKFTSAQ-XKBNMCJKSA-N |
| XLogP | 5.61 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|