C20H27NO — CID 143166214
15-imino-2,16-dimethyltetracyclo[9.7.0.02,7.012,16]octadeca-6,8-dien-5-one (PubChem CID 143166214) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is 15-imino-2,16-dimethyltetracyclo[9.7.0.02,7.012,16]octadeca-6,8-dien-5-one.
| Compound Name | 15-imino-2,16-dimethyltetracyclo[9.7.0.02,7.012,16]octadeca-6,8-dien-5-one |
|---|---|
| PubChem CID | 143166214 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 15-imino-2,16-dimethyltetracyclo[9.7.0.02,7.012,16]octadeca-6,8-dien-5-one |
| SMILES | [H]/N=C1\CCC2C3CC=CC4=CC(=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C20H27NO/c1-19-10-8-14(22)12-13(19)4-3-5-15-16-6-7-18(21)20(16,2)11-9-17(15)19/h3-4,12,15-17,21H,5-11H2,1-2H3/b21-18+ |
| InChIKey | OYOZHHZKZUPVSJ-DYTRJAOYSA-N |
| XLogP | 4.70 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|