C19H22FNO2 — CID 57123722
(8R,9S,10R,13S,14S)-6-fluoro-4-imino-10,13-dimethyl-5,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 57123722) has the molecular formula C19H22FNO2 and a molecular weight of 315.39 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-6-fluoro-4-imino-10,13-dimethyl-5,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10R,13S,14S)-6-fluoro-4-imino-10,13-dimethyl-5,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 57123722 |
| Molecular Formula | C19H22FNO2 |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (8R,9S,10R,13S,14S)-6-fluoro-4-imino-10,13-dimethyl-5,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | [H]/N=C1\C(=O)C=C[C@@]2(C)C1C(F)=C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C19H22FNO2/c1-18-7-5-12-10(11(18)3-4-15(18)23)9-13(20)16-17(21)14(22)6-8-19(12,16)2/h6,8-12,16,21H,3-5,7H2,1-2H3/b21-17+/t10-,11-,12-,16?,18-,19+/m0/s1 |
| InChIKey | TVMHVCJCEBWPNE-LDWQSCHZSA-N |
| XLogP | 3.65 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|