C20H24FNO2 — CID 57035918
(8R,9S,10R,13S,14S)-6-(fluoromethylidene)-4-imino-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-5H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 57035918) has the molecular formula C20H24FNO2 and a molecular weight of 329.41 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-6-(fluoromethylidene)-4-imino-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-5H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10R,13S,14S)-6-(fluoromethylidene)-4-imino-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-5H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 57035918 |
| Molecular Formula | C20H24FNO2 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | (8R,9S,10R,13S,14S)-6-(fluoromethylidene)-4-imino-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-5H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | [H]/N=C1\C(=O)C=C[C@@]2(C)C1C(=CF)C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C20H24FNO2/c1-19-7-5-14-12(13(19)3-4-16(19)24)9-11(10-21)17-18(22)15(23)6-8-20(14,17)2/h6,8,10,12-14,17,22H,3-5,7,9H2,1-2H3/b11-10?,22-18+/t12-,13-,14-,17?,19-,20+/m0/s1 |
| InChIKey | VZWHAIDGPWGGJU-ZZUHHVHUSA-N |
| XLogP | 4.04 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|