C11H15NO — CID 123160987
6-imino-4a-methyl-3,4,5,8a-tetrahydro-2H-naphthalen-1-one (PubChem CID 123160987) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 6-imino-4a-methyl-3,4,5,8a-tetrahydro-2H-naphthalen-1-one.
| Compound Name | 6-imino-4a-methyl-3,4,5,8a-tetrahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 123160987 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 6-imino-4a-methyl-3,4,5,8a-tetrahydro-2H-naphthalen-1-one |
| SMILES | [H]/N=C1\C=CC2C(=O)CCCC2(C)C1 |
| InChI | InChI=1S/C11H15NO/c1-11-6-2-3-10(13)9(11)5-4-8(12)7-11/h4-5,9,12H,2-3,6-7H2,1H3/b12-8+ |
| InChIKey | CKEBEQGJKWDQNU-XYOKQWHBSA-N |
| XLogP | 2.34 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|