C13H19NO — CID 123323603
3-imino-2-(2-methylhexa-3,5-dienyl)cyclohexan-1-one (PubChem CID 123323603) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 3-imino-2-(2-methylhexa-3,5-dienyl)cyclohexan-1-one.
| Compound Name | 3-imino-2-(2-methylhexa-3,5-dienyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 123323603 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 3-imino-2-(2-methylhexa-3,5-dienyl)cyclohexan-1-one |
| SMILES | [H]/N=C1\CCCC(=O)C1CC(C)C=CC=C |
| InChI | InChI=1S/C13H19NO/c1-3-4-6-10(2)9-11-12(14)7-5-8-13(11)15/h3-4,6,10-11,14H,1,5,7-9H2,2H3/b6-4?,14-12+ |
| InChIKey | DWZUMWQVOJEPHT-CALOEKBMSA-N |
| XLogP | 3.14 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|