C15H25NO — CID 123237655
4,5-dimethyl-6-propanimidoyldeca-1,6-dien-3-one (PubChem CID 123237655) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 4,5-dimethyl-6-propanimidoyldeca-1,6-dien-3-one.
| Compound Name | 4,5-dimethyl-6-propanimidoyldeca-1,6-dien-3-one |
|---|---|
| PubChem CID | 123237655 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 4,5-dimethyl-6-propanimidoyldeca-1,6-dien-3-one |
| SMILES | [H]/N=C(\CC)C(=CCCC)C(C)C(C)C(=O)C=C |
| InChI | InChI=1S/C15H25NO/c1-6-9-10-13(14(16)7-2)11(4)12(5)15(17)8-3/h8,10-12,16H,3,6-7,9H2,1-2,4-5H3/b13-10?,16-14+ |
| InChIKey | CJULSDFOKNMNJS-FBQFHJERSA-N |
| XLogP | 4.17 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|