C14H23NO — CID 123272303
9-imino-3,7,10-trimethylundeca-7,10-dien-2-one (PubChem CID 123272303) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 9-imino-3,7,10-trimethylundeca-7,10-dien-2-one.
| Compound Name | 9-imino-3,7,10-trimethylundeca-7,10-dien-2-one |
|---|---|
| PubChem CID | 123272303 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 9-imino-3,7,10-trimethylundeca-7,10-dien-2-one |
| SMILES | [H]/N=C(/C=C(C)CCCC(C)C(C)=O)C(=C)C |
| InChI | InChI=1S/C14H23NO/c1-10(2)14(15)9-11(3)7-6-8-12(4)13(5)16/h9,12,15H,1,6-8H2,2-5H3/b11-9?,15-14- |
| InChIKey | USIOXGAGUGFXQE-UHKYADABSA-N |
| XLogP | 3.92 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|