C21H27NO2 — CID 57184820
(8S,10S,13S,14S,17S)-17-acetyl-4-imino-10,13-dimethyl-2,5,8,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 57184820) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is (8S,10S,13S,14S,17S)-17-acetyl-4-imino-10,13-dimethyl-2,5,8,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10S,13S,14S,17S)-17-acetyl-4-imino-10,13-dimethyl-2,5,8,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57184820 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | (8S,10S,13S,14S,17S)-17-acetyl-4-imino-10,13-dimethyl-2,5,8,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | [H]/N=C1\C(=O)CC[C@]2(C)C3=CC[C@]4(C)[C@@H](C(C)=O)CC[C@H]4[C@@H]3C=CC12 |
| InChI | InChI=1S/C21H27NO2/c1-12(23)14-6-7-15-13-4-5-17-19(22)18(24)9-11-21(17,3)16(13)8-10-20(14,15)2/h4-5,8,13-15,17,22H,6-7,9-11H2,1-3H3/b22-19-/t13-,14+,15-,17?,20+,21+/m0/s1 |
| InChIKey | ORECNMPMDRWCMP-QXNOESFKSA-N |
| XLogP | 4.13 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|