C14H19NO — CID 123949666
3-(6-cyclopropylcyclohexa-1,5-dien-1-yl)-4-iminopentan-2-one (PubChem CID 123949666) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 3-(6-cyclopropylcyclohexa-1,5-dien-1-yl)-4-iminopentan-2-one.
| Compound Name | 3-(6-cyclopropylcyclohexa-1,5-dien-1-yl)-4-iminopentan-2-one |
|---|---|
| PubChem CID | 123949666 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 3-(6-cyclopropylcyclohexa-1,5-dien-1-yl)-4-iminopentan-2-one |
| SMILES | [H]/N=C(\C)C(C(C)=O)C1=CCCC=C1C1CC1 |
| InChI | InChI=1S/C14H19NO/c1-9(15)14(10(2)16)13-6-4-3-5-12(13)11-7-8-11/h5-6,11,14-15H,3-4,7-8H2,1-2H3/b15-9+ |
| InChIKey | WKKSTLHVKLFWMK-OQLLNIDSSA-N |
| XLogP | 3.29 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|