C21H27NO — CID 142376058
1-[(9S,10S,13R,17S)-3-imino-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 142376058) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is 1-[(9S,10S,13R,17S)-3-imino-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(9S,10S,13R,17S)-3-imino-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 142376058 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 1-[(9S,10S,13R,17S)-3-imino-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | [H]/N=C1/C=C2C=CC3=C4CC[C@H](C(C)=O)[C@@]4(C)CC[C@H]3[C@]2(C)CC1 |
| InChI | InChI=1S/C21H27NO/c1-13(23)17-6-7-18-16-5-4-14-12-15(22)8-10-20(14,2)19(16)9-11-21(17,18)3/h4-5,12,17,19,22H,6-11H2,1-3H3/b22-15+/t17-,19-,20-,21-/m1/s1 |
| InChIKey | SEBCOFOUQNILRF-WJUYMNQQSA-N |
| XLogP | 5.01 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|