C20H27NO2 — CID 57178248
(8R,9R,10R,13S,14S,17S)-17-acetyl-4-imino-13-methyl-1,2,5,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 57178248) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S,17S)-17-acetyl-4-imino-13-methyl-1,2,5,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9R,10R,13S,14S,17S)-17-acetyl-4-imino-13-methyl-1,2,5,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57178248 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (8R,9R,10R,13S,14S,17S)-17-acetyl-4-imino-13-methyl-1,2,5,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | [H]/N=C1\C(=O)CC[C@H]2C1C=C[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](C(C)=O)CC[C@@H]12 |
| InChI | InChI=1S/C20H27NO2/c1-11(22)16-6-7-17-14-3-4-15-12(5-8-18(23)19(15)21)13(14)9-10-20(16,17)2/h3-4,12-17,21H,5-10H2,1-2H3/b21-19-/t12-,13-,14-,15?,16-,17+,20-/m1/s1 |
| InChIKey | JJCPPEDMFUUBRI-SGVCUDODSA-N |
| XLogP | 3.82 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|