C21H27NO2 — CID 57084479
(8R,9S,10R,13S,14S)-7-ethenyl-4-imino-10,13-dimethyl-1,2,5,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 57084479) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-7-ethenyl-4-imino-10,13-dimethyl-1,2,5,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10R,13S,14S)-7-ethenyl-4-imino-10,13-dimethyl-1,2,5,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 57084479 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | (8R,9S,10R,13S,14S)-7-ethenyl-4-imino-10,13-dimethyl-1,2,5,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | [H]/N=C1\C(=O)CC[C@@]2(C)C1C=C(C=C)[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C21H27NO2/c1-4-12-11-15-19(22)16(23)8-10-20(15,2)14-7-9-21(3)13(18(12)14)5-6-17(21)24/h4,11,13-15,18,22H,1,5-10H2,2-3H3/b22-19-/t13-,14-,15?,18-,20+,21-/m0/s1 |
| InChIKey | KGORZLKWSHJEGY-DTINUWPQSA-N |
| XLogP | 4.13 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|