C18H14F5NO3S2 — CID 163799616
2-(3-ethylsulfonyl-1-benzothiophen-2-yl)-5-(2,2,3,3,3-pentafluoropropoxy)pyridine (PubChem CID 163799616) has the molecular formula C18H14F5NO3S2 and a molecular weight of 451.44 g/mol. Its IUPAC name is 2-(3-ethylsulfonyl-1-benzothiophen-2-yl)-5-(2,2,3,3,3-pentafluoropropoxy)pyridine.
| Compound Name | 2-(3-ethylsulfonyl-1-benzothiophen-2-yl)-5-(2,2,3,3,3-pentafluoropropoxy)pyridine |
|---|---|
| PubChem CID | 163799616 |
| Molecular Formula | C18H14F5NO3S2 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | 2-(3-ethylsulfonyl-1-benzothiophen-2-yl)-5-(2,2,3,3,3-pentafluoropropoxy)pyridine |
| SMILES | CCS(=O)(=O)c1c(-c2ccc(OCC(F)(F)C(F)(F)F)cn2)sc2ccccc12 |
| InChI | InChI=1S/C18H14F5NO3S2/c1-2-29(25,26)16-12-5-3-4-6-14(12)28-15(16)13-8-7-11(9-24-13)27-10-17(19,20)18(21,22)23/h3-9H,2,10H2,1H3 |
| InChIKey | NDVVTRWAZRZVSY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|