C18H19F4N3O3S2 — CID 90137899
(3S)-3-[3-fluoro-5-(5-methoxy-3-pyridinyl)thiophen-2-yl]-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-5-amine (PubChem CID 90137899) has the molecular formula C18H19F4N3O3S2 and a molecular weight of 465.49 g/mol. Its IUPAC name is (3S)-3-[3-fluoro-5-(5-methoxy-3-pyridinyl)thiophen-2-yl]-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-5-amine.
| Compound Name | (3S)-3-[3-fluoro-5-(5-methoxy-3-pyridinyl)thiophen-2-yl]-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 90137899 |
| Molecular Formula | C18H19F4N3O3S2 |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | (3S)-3-[3-fluoro-5-(5-methoxy-3-pyridinyl)thiophen-2-yl]-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-5-amine |
| SMILES | COc1cncc(-c2cc(F)c([C@]3(C)CS(=O)(=O)C(C)(CC(F)(F)F)C(N)=N3)s2)c1 |
| InChI | InChI=1S/C18H19F4N3O3S2/c1-16(9-30(26,27)17(2,15(23)25-16)8-18(20,21)22)14-12(19)5-13(29-14)10-4-11(28-3)7-24-6-10/h4-7H,8-9H2,1-3H3,(H2,23,25)/t16-,17?/m0/s1 |
| InChIKey | UDOIOWAQRBOTGU-BHWOMJMDSA-N |
| XLogP | 3.67 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |