C19H18F3NO3S — CID 22917358
3-methoxy-5-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]-2-(trifluoromethyl)pyridine (PubChem CID 22917358) has the molecular formula C19H18F3NO3S and a molecular weight of 397.42 g/mol. Its IUPAC name is 3-methoxy-5-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]-2-(trifluoromethyl)pyridine.
| Compound Name | 3-methoxy-5-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 22917358 |
| Molecular Formula | C19H18F3NO3S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 3-methoxy-5-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]-2-(trifluoromethyl)pyridine |
| SMILES | COc1cc(C2=C(c3ccc(S(C)(=O)=O)cc3)CCC2)cnc1C(F)(F)F |
| InChI | InChI=1S/C19H18F3NO3S/c1-26-17-10-13(11-23-18(17)19(20,21)22)16-5-3-4-15(16)12-6-8-14(9-7-12)27(2,24)25/h6-11H,3-5H2,1-2H3 |
| InChIKey | QDZVOGIIPOVWBK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |