C17H26N2O3 — CID 163802237
propan-2-yl N-[1-[1-(4-ethylphenyl)ethylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 163802237) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is propan-2-yl N-[1-[1-(4-ethylphenyl)ethylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | propan-2-yl N-[1-[1-(4-ethylphenyl)ethylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 163802237 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | propan-2-yl N-[1-[1-(4-ethylphenyl)ethylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCc1ccc(C(C)NC(=O)C(C)NC(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C17H26N2O3/c1-6-14-7-9-15(10-8-14)12(4)18-16(20)13(5)19-17(21)22-11(2)3/h7-13H,6H2,1-5H3,(H,18,20)(H,19,21) |
| InChIKey | QITSAYPGZSTYAP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |