C19H30N2O3 — CID 15215908
propan-2-yl N-[1-[1-(4-ethylphenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 15215908) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is propan-2-yl N-[1-[1-(4-ethylphenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | propan-2-yl N-[1-[1-(4-ethylphenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 15215908 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | propan-2-yl N-[1-[1-(4-ethylphenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCc1ccc(C(C)NC(=O)C(NC(=O)OC(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C19H30N2O3/c1-7-15-8-10-16(11-9-15)14(6)20-18(22)17(12(2)3)21-19(23)24-13(4)5/h8-14,17H,7H2,1-6H3,(H,20,22)(H,21,23) |
| InChIKey | IDVNLHRKMGRIKE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |