C17H25ClN2O3 — CID 22856211
propan-2-yl N-[(2S)-1-[2-(4-chlorophenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 22856211) has the molecular formula C17H25ClN2O3 and a molecular weight of 340.85 g/mol. Its IUPAC name is propan-2-yl N-[(2S)-1-[2-(4-chlorophenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | propan-2-yl N-[(2S)-1-[2-(4-chlorophenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 22856211 |
| Molecular Formula | C17H25ClN2O3 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | propan-2-yl N-[(2S)-1-[2-(4-chlorophenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)OC(=O)N[C@H](C(=O)NCCc1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C17H25ClN2O3/c1-11(2)15(20-17(22)23-12(3)4)16(21)19-10-9-13-5-7-14(18)8-6-13/h5-8,11-12,15H,9-10H2,1-4H3,(H,19,21)(H,20,22)/t15-/m0/s1 |
| InChIKey | ZOSOHFBVIZXVEI-HNNXBMFYSA-N |
| XLogP | 3.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |