About 7-fluoro-N-methyl-3,5-dihydro-2H-naphthalen-1-imine oxide
7-fluoro-N-methyl-3,5-dihydro-2H-naphthalen-1-imine oxide (PubChem CID 163802359) has the molecular formula C11H12FNO
and a molecular weight of 193.22 g/mol. Its IUPAC name is 7-fluoro-N-methyl-3,5-dihydro-2H-naphthalen-1-imine oxide.
Molecular Properties
| Compound Name | 7-fluoro-N-methyl-3,5-dihydro-2H-naphthalen-1-imine oxide |
| PubChem CID | 163802359 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 7-fluoro-N-methyl-3,5-dihydro-2H-naphthalen-1-imine oxide |
| SMILES | C/[N+]([O-])=C1/CCC=C2CC=C(F)C=C21 |
| InChI | InChI=1S/C11H12FNO/c1-13(14)11-4-2-3-8-5-6-9(12)7-10(8)11/h3,6-7H,2,4-5H2,1H3/b13-11+ |
| InChIKey | NGBYLBUOQUCBGV-ACCUITESSA-N |
| XLogP | 2.47 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-N-methyl-3,5-dihydro-2H-naphthalen-1-imine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-N-methyl-3,5-dihydro-2H-naphthalen-1-imine oxide?
The IUPAC name of 7-fluoro-N-methyl-3,5-dihydro-2H-naphthalen-1-imine oxide (CID 163802359) is 7-fluoro-N-methyl-3,5-dihydro-2H-naphthalen-1-imine oxide.
What is the SMILES notation for 7-fluoro-N-methyl-3,5-dihydro-2H-naphthalen-1-imine oxide?
The canonical SMILES for 7-fluoro-N-methyl-3,5-dihydro-2H-naphthalen-1-imine oxide is C/[N+]([O-])=C1/CCC=C2CC=C(F)C=C21.
What is the InChIKey of 7-fluoro-N-methyl-3,5-dihydro-2H-naphthalen-1-imine oxide?
The InChIKey is NGBYLBUOQUCBGV-ACCUITESSA-N. The full InChI is InChI=1S/C11H12FNO/c1-13(14)11-4-2-3-8-5-6-9(12)7-10(8)11/h3,6-7H,2,4-5H2,1H3/b13-11+.
What are the key properties of 7-fluoro-N-methyl-3,5-dihydro-2H-naphthalen-1-imine oxide?
7-fluoro-N-methyl-3,5-dihydro-2H-naphthalen-1-imine oxide has a molecular weight of 193.22 g/mol, XLogP of 2.47, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-N-methyl-3,5-dihydro-2H-naphthalen-1-imine oxide is sourced from PubChem (CID 163802359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).