C10H13NO — CID 150315927
2-methyl-1-oxido-2,6,7,8-tetrahydroquinolin-1-ium (PubChem CID 150315927) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-methyl-1-oxido-2,6,7,8-tetrahydroquinolin-1-ium.
| Compound Name | 2-methyl-1-oxido-2,6,7,8-tetrahydroquinolin-1-ium |
|---|---|
| PubChem CID | 150315927 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 2-methyl-1-oxido-2,6,7,8-tetrahydroquinolin-1-ium |
| SMILES | CC1C=CC2=CCCCC2=[N+]1[O-] |
| InChI | InChI=1S/C10H13NO/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h4,6-8H,2-3,5H2,1H3 |
| InChIKey | GMPJGIHTLBWHFN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|