C12H20 — CID 123921718
1-ethyl-3,4-dimethylcycloocta-1,4-diene (PubChem CID 123921718) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is 1-ethyl-3,4-dimethylcycloocta-1,4-diene.
| Compound Name | 1-ethyl-3,4-dimethylcycloocta-1,4-diene |
|---|---|
| PubChem CID | 123921718 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 1-ethyl-3,4-dimethylcycloocta-1,4-diene |
| SMILES | CCC1=CC(C)C(C)=CCCC1 |
| InChI | InChI=1S/C12H20/c1-4-12-8-6-5-7-10(2)11(3)9-12/h7,9,11H,4-6,8H2,1-3H3 |
| InChIKey | SAPSPMBPNQKFKN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|