C19H24Cl2 — CID 123926884
6-[(2,6-dichloro-4-methylphenyl)methylidene]-1-ethylcyclononene (PubChem CID 123926884) has the molecular formula C19H24Cl2 and a molecular weight of 323.31 g/mol. Its IUPAC name is 6-[(2,6-dichloro-4-methylphenyl)methylidene]-1-ethylcyclononene.
| Compound Name | 6-[(2,6-dichloro-4-methylphenyl)methylidene]-1-ethylcyclononene |
|---|---|
| PubChem CID | 123926884 |
| Molecular Formula | C19H24Cl2 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 6-[(2,6-dichloro-4-methylphenyl)methylidene]-1-ethylcyclononene |
| SMILES | CCC1=CCCCC(=Cc2c(Cl)cc(C)cc2Cl)CCC1 |
| InChI | InChI=1S/C19H24Cl2/c1-3-15-7-4-5-8-16(10-6-9-15)13-17-18(20)11-14(2)12-19(17)21/h7,11-13H,3-6,8-10H2,1-2H3 |
| InChIKey | HPCWXKXNRLNNGS-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|