C16H24N2O2S — CID 79884493
3-amino-N-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylbenzenesulfonamide (PubChem CID 79884493) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is 3-amino-N-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylbenzenesulfonamide.
| Compound Name | 3-amino-N-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 79884493 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 3-amino-N-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(N)c(C)c(S(=O)(=O)NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C16H24N2O2S/c1-12-10-15(17)13(2)16(11-12)21(19,20)18-9-8-14-6-4-3-5-7-14/h6,10-11,18H,3-5,7-9,17H2,1-2H3 |
| InChIKey | YMMVJVNMBCCNMY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|