C11H16 — CID 142052092
2-methyl-1,2,3,5,6,7-hexahydroazulene (PubChem CID 142052092) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is 2-methyl-1,2,3,5,6,7-hexahydroazulene.
| Compound Name | 2-methyl-1,2,3,5,6,7-hexahydroazulene |
|---|---|
| PubChem CID | 142052092 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 2-methyl-1,2,3,5,6,7-hexahydroazulene |
| SMILES | CC1CC2=CCCCC=C2C1 |
| InChI | InChI=1S/C11H16/c1-9-7-10-5-3-2-4-6-11(10)8-9/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | YUYFTGMPZIWFOB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |