C8H14 — CID 520362
1,5-dimethylcyclohexene (PubChem CID 520362) has the molecular formula C8H14 and a molecular weight of 110.20 g/mol. Its IUPAC name is 1,5-dimethylcyclohexene.
| Compound Name | 1,5-dimethylcyclohexene |
|---|---|
| PubChem CID | 520362 |
| Molecular Formula | C8H14 |
| Molecular Weight | 110.20 g/mol |
| Exact Mass | 110.11 |
| IUPAC Name | 1,5-dimethylcyclohexene |
| SMILES | CC1=CCCC(C)C1 |
| InChI | InChI=1S/C8H14/c1-7-4-3-5-8(2)6-7/h4,8H,3,5-6H2,1-2H3 |
| InChIKey | QOSLKKIVSIPIFE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.20 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|