C21H36O — CID 91416681
(1S)-2-tert-butyl-5,9,13-trimethylcyclotetradeca-2,8,12-trien-1-ol (PubChem CID 91416681) has the molecular formula C21H36O and a molecular weight of 304.52 g/mol. Its IUPAC name is (1S)-2-tert-butyl-5,9,13-trimethylcyclotetradeca-2,8,12-trien-1-ol.
| Compound Name | (1S)-2-tert-butyl-5,9,13-trimethylcyclotetradeca-2,8,12-trien-1-ol |
|---|---|
| PubChem CID | 91416681 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | (1S)-2-tert-butyl-5,9,13-trimethylcyclotetradeca-2,8,12-trien-1-ol |
| SMILES | CC1=CCCC(C)CC=C(C(C)(C)C)[C@@H](O)CC(C)=CCC1 |
| InChI | InChI=1S/C21H36O/c1-16-9-7-11-17(2)13-14-19(21(4,5)6)20(22)15-18(3)12-8-10-16/h9,12,14,17,20,22H,7-8,10-11,13,15H2,1-6H3/t17?,20-/m0/s1 |
| InChIKey | JZBFORRIXBZRJM-OZBJMMHXSA-N |
| XLogP | 6.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|