C20H32O — CID 72739214
3,9,13-trimethyl-6-propan-2-ylcyclotetradeca-3,5,9-trien-1-one (PubChem CID 72739214) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is 3,9,13-trimethyl-6-propan-2-ylcyclotetradeca-3,5,9-trien-1-one.
| Compound Name | 3,9,13-trimethyl-6-propan-2-ylcyclotetradeca-3,5,9-trien-1-one |
|---|---|
| PubChem CID | 72739214 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 3,9,13-trimethyl-6-propan-2-ylcyclotetradeca-3,5,9-trien-1-one |
| SMILES | CC1=CCCC(C)CC(=O)CC(C)=CC=C(C(C)C)CC1 |
| InChI | InChI=1S/C20H32O/c1-15(2)19-11-9-16(3)7-6-8-17(4)13-20(21)14-18(5)10-12-19/h7,10,12,15,17H,6,8-9,11,13-14H2,1-5H3 |
| InChIKey | YUNYFWSRJFQWRJ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|