C22H27FN2O5S — CID 163803317
(E)-2-[(2-tert-butyl-1,3-benzoxazol-6-yl)oxymethyl]-3-fluoroprop-2-en-1-amine;4-methylbenzenesulfonic acid (PubChem CID 163803317) has the molecular formula C22H27FN2O5S and a molecular weight of 450.53 g/mol. Its IUPAC name is (E)-2-[(2-tert-butyl-1,3-benzoxazol-6-yl)oxymethyl]-3-fluoroprop-2-en-1-amine;4-methylbenzenesulfonic acid.
| Compound Name | (E)-2-[(2-tert-butyl-1,3-benzoxazol-6-yl)oxymethyl]-3-fluoroprop-2-en-1-amine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 163803317 |
| Molecular Formula | C22H27FN2O5S |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | (E)-2-[(2-tert-butyl-1,3-benzoxazol-6-yl)oxymethyl]-3-fluoroprop-2-en-1-amine;4-methylbenzenesulfonic acid |
| SMILES | CC(C)(C)c1nc2ccc(OC/C(=C/F)CN)cc2o1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C15H19FN2O2.C7H8O3S/c1-15(2,3)14-18-12-5-4-11(6-13(12)20-14)19-9-10(7-16)8-17;1-6-2-4-7(5-3-6)11(8,9)10/h4-7H,8-9,17H2,1-3H3;2-5H,1H3,(H,8,9,10)/b10-7+; |
| InChIKey | CONRLVSDTOIELK-HCUGZAAXSA-N |
| XLogP | 4.56 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|