C20H22FN3O5S — CID 175139023
ethyl 2-[[6-[(E)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-1,3-benzoxazol-2-yl]amino]-4-methylbenzenesulfonate (PubChem CID 175139023) has the molecular formula C20H22FN3O5S and a molecular weight of 435.48 g/mol. Its IUPAC name is ethyl 2-[[6-[(E)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-1,3-benzoxazol-2-yl]amino]-4-methylbenzenesulfonate.
| Compound Name | ethyl 2-[[6-[(E)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-1,3-benzoxazol-2-yl]amino]-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 175139023 |
| Molecular Formula | C20H22FN3O5S |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | ethyl 2-[[6-[(E)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-1,3-benzoxazol-2-yl]amino]-4-methylbenzenesulfonate |
| SMILES | CCOS(=O)(=O)c1ccc(C)cc1Nc1nc2ccc(OC/C(=C/F)CN)cc2o1 |
| InChI | InChI=1S/C20H22FN3O5S/c1-3-28-30(25,26)19-7-4-13(2)8-17(19)24-20-23-16-6-5-15(9-18(16)29-20)27-12-14(10-21)11-22/h4-10H,3,11-12,22H2,1-2H3,(H,23,24)/b14-10+ |
| InChIKey | IMFPKQMEQLVWDD-GXDHUFHOSA-N |
| XLogP | 3.80 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|