C16H11F3N2O2S — CID 163803322
3-[[(1S,2S,3R)-7-aminosulfanyl-2,3-difluoro-1-hydroxy-2,3-dihydro-1H-inden-4-yl]oxy]-5-fluorobenzonitrile (PubChem CID 163803322) has the molecular formula C16H11F3N2O2S and a molecular weight of 352.34 g/mol. Its IUPAC name is 3-[[(1S,2S,3R)-7-aminosulfanyl-2,3-difluoro-1-hydroxy-2,3-dihydro-1H-inden-4-yl]oxy]-5-fluorobenzonitrile.
| Compound Name | 3-[[(1S,2S,3R)-7-aminosulfanyl-2,3-difluoro-1-hydroxy-2,3-dihydro-1H-inden-4-yl]oxy]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 163803322 |
| Molecular Formula | C16H11F3N2O2S |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 3-[[(1S,2S,3R)-7-aminosulfanyl-2,3-difluoro-1-hydroxy-2,3-dihydro-1H-inden-4-yl]oxy]-5-fluorobenzonitrile |
| SMILES | N#Cc1cc(F)cc(Oc2ccc(SN)c3c2[C@@H](F)[C@@H](F)[C@H]3O)c1 |
| InChI | InChI=1S/C16H11F3N2O2S/c17-8-3-7(6-20)4-9(5-8)23-10-1-2-11(24-21)13-12(10)14(18)15(19)16(13)22/h1-5,14-16,22H,21H2/t14-,15-,16+/m1/s1 |
| InChIKey | NGVYJUMPRYNQLB-OAGGEKHMSA-N |
| XLogP | 3.85 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|