C18H16FNO3S — CID 138637851
3-[(7-ethoxysulfanyl-1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]-5-fluorobenzonitrile (PubChem CID 138637851) has the molecular formula C18H16FNO3S and a molecular weight of 345.40 g/mol. Its IUPAC name is 3-[(7-ethoxysulfanyl-1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]-5-fluorobenzonitrile.
| Compound Name | 3-[(7-ethoxysulfanyl-1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 138637851 |
| Molecular Formula | C18H16FNO3S |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 3-[(7-ethoxysulfanyl-1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]-5-fluorobenzonitrile |
| SMILES | CCOSc1ccc(Oc2cc(F)cc(C#N)c2)c2c1C(O)CC2 |
| InChI | InChI=1S/C18H16FNO3S/c1-2-22-24-17-6-5-16(14-3-4-15(21)18(14)17)23-13-8-11(10-20)7-12(19)9-13/h5-9,15,21H,2-4H2,1H3 |
| InChIKey | SZTDJGYBRJWIRZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|