C18H15F2NO4S — CID 146662707
[(2S,3S)-7-(3-cyano-5-fluorophenoxy)-2-fluoro-3-hydroxy-2-methyl-1,3-dihydroinden-4-yl]methanesulfinic acid (PubChem CID 146662707) has the molecular formula C18H15F2NO4S and a molecular weight of 379.38 g/mol. Its IUPAC name is [(2S,3S)-7-(3-cyano-5-fluorophenoxy)-2-fluoro-3-hydroxy-2-methyl-1,3-dihydroinden-4-yl]methanesulfinic acid.
| Compound Name | [(2S,3S)-7-(3-cyano-5-fluorophenoxy)-2-fluoro-3-hydroxy-2-methyl-1,3-dihydroinden-4-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 146662707 |
| Molecular Formula | C18H15F2NO4S |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | [(2S,3S)-7-(3-cyano-5-fluorophenoxy)-2-fluoro-3-hydroxy-2-methyl-1,3-dihydroinden-4-yl]methanesulfinic acid |
| SMILES | C[C@]1(F)Cc2c(Oc3cc(F)cc(C#N)c3)ccc(CS(=O)O)c2[C@@H]1O |
| InChI | InChI=1S/C18H15F2NO4S/c1-18(20)7-14-15(25-13-5-10(8-21)4-12(19)6-13)3-2-11(9-26(23)24)16(14)17(18)22/h2-6,17,22H,7,9H2,1H3,(H,23,24)/t17-,18-/m0/s1 |
| InChIKey | MGEGATJQNHRFOY-ROUUACIJSA-N |
| XLogP | 3.53 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|