C19H14F3NO5S — CID 134519100
[(3S)-3-acetyloxy-7-(3-cyano-5-fluorophenoxy)-2,2-difluoro-1,3-dihydroinden-4-yl]methanesulfinic acid (PubChem CID 134519100) has the molecular formula C19H14F3NO5S and a molecular weight of 425.38 g/mol. Its IUPAC name is [(3S)-3-acetyloxy-7-(3-cyano-5-fluorophenoxy)-2,2-difluoro-1,3-dihydroinden-4-yl]methanesulfinic acid.
| Compound Name | [(3S)-3-acetyloxy-7-(3-cyano-5-fluorophenoxy)-2,2-difluoro-1,3-dihydroinden-4-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 134519100 |
| Molecular Formula | C19H14F3NO5S |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | [(3S)-3-acetyloxy-7-(3-cyano-5-fluorophenoxy)-2,2-difluoro-1,3-dihydroinden-4-yl]methanesulfinic acid |
| SMILES | CC(=O)O[C@H]1c2c(CS(=O)O)ccc(Oc3cc(F)cc(C#N)c3)c2CC1(F)F |
| InChI | InChI=1S/C19H14F3NO5S/c1-10(24)27-18-17-12(9-29(25)26)2-3-16(15(17)7-19(18,21)22)28-14-5-11(8-23)4-13(20)6-14/h2-6,18H,7,9H2,1H3,(H,25,26)/t18-/m0/s1 |
| InChIKey | CVLUPRVGYJYJHM-SFHVURJKSA-N |
| XLogP | 4.01 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|