C21H20FNO2S — CID 147132891
3-[7-[(Z)-ethylidene(methyl)-λ4-sulfanyl]-1-hydroxyspiro[1,3-dihydroindene-2,1'-cyclopropane]-4-yl]oxy-5-fluorobenzonitrile (PubChem CID 147132891) has the molecular formula C21H20FNO2S and a molecular weight of 369.46 g/mol. Its IUPAC name is 3-[7-[(Z)-ethylidene(methyl)-λ4-sulfanyl]-1-hydroxyspiro[1,3-dihydroindene-2,1'-cyclopropane]-4-yl]oxy-5-fluorobenzonitrile.
| Compound Name | 3-[7-[(Z)-ethylidene(methyl)-λ4-sulfanyl]-1-hydroxyspiro[1,3-dihydroindene-2,1'-cyclopropane]-4-yl]oxy-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 147132891 |
| Molecular Formula | C21H20FNO2S |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 3-[7-[(Z)-ethylidene(methyl)-λ4-sulfanyl]-1-hydroxyspiro[1,3-dihydroindene-2,1'-cyclopropane]-4-yl]oxy-5-fluorobenzonitrile |
| SMILES | C/C=S(/C)c1ccc(Oc2cc(F)cc(C#N)c2)c2c1C(O)C1(CC1)C2 |
| InChI | InChI=1S/C21H20FNO2S/c1-3-26(2)18-5-4-17(16-11-21(6-7-21)20(24)19(16)18)25-15-9-13(12-23)8-14(22)10-15/h3-5,8-10,20,24H,6-7,11H2,1-2H3 |
| InChIKey | BQOOJVNEBZLVSR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|