C17H12F2NO4S- — CID 134248631
[(2R,3S)-7-(3-cyano-5-fluorophenoxy)-2-fluoro-3-hydroxy-2,3-dihydro-1H-inden-4-yl]methanesulfinate (PubChem CID 134248631) has the molecular formula C17H12F2NO4S- and a molecular weight of 364.35 g/mol. Its IUPAC name is [(2R,3S)-7-(3-cyano-5-fluorophenoxy)-2-fluoro-3-hydroxy-2,3-dihydro-1H-inden-4-yl]methanesulfinate.
| Compound Name | [(2R,3S)-7-(3-cyano-5-fluorophenoxy)-2-fluoro-3-hydroxy-2,3-dihydro-1H-inden-4-yl]methanesulfinate |
|---|---|
| PubChem CID | 134248631 |
| Molecular Formula | C17H12F2NO4S- |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | [(2R,3S)-7-(3-cyano-5-fluorophenoxy)-2-fluoro-3-hydroxy-2,3-dihydro-1H-inden-4-yl]methanesulfinate |
| SMILES | N#Cc1cc(F)cc(Oc2ccc(CS(=O)[O-])c3c2C[C@@H](F)[C@H]3O)c1 |
| InChI | InChI=1S/C17H13F2NO4S/c18-11-3-9(7-20)4-12(5-11)24-15-2-1-10(8-25(22)23)16-13(15)6-14(19)17(16)21/h1-5,14,17,21H,6,8H2,(H,22,23)/p-1/t14-,17-/m1/s1 |
| InChIKey | FVZBFLABINNEGE-RHSMWYFYSA-M |
| XLogP | 2.80 |
| TPSA | 93.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|