C18H13FNO4S- — CID 146662701
1-[7-(3-cyano-5-fluorophenoxy)-3-oxo-1,2-dihydroinden-4-yl]ethanesulfinate (PubChem CID 146662701) has the molecular formula C18H13FNO4S- and a molecular weight of 358.37 g/mol. Its IUPAC name is 1-[7-(3-cyano-5-fluorophenoxy)-3-oxo-1,2-dihydroinden-4-yl]ethanesulfinate.
| Compound Name | 1-[7-(3-cyano-5-fluorophenoxy)-3-oxo-1,2-dihydroinden-4-yl]ethanesulfinate |
|---|---|
| PubChem CID | 146662701 |
| Molecular Formula | C18H13FNO4S- |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 1-[7-(3-cyano-5-fluorophenoxy)-3-oxo-1,2-dihydroinden-4-yl]ethanesulfinate |
| SMILES | CC(c1ccc(Oc2cc(F)cc(C#N)c2)c2c1C(=O)CC2)S(=O)[O-] |
| InChI | InChI=1S/C18H14FNO4S/c1-10(25(22)23)14-3-5-17(15-2-4-16(21)18(14)15)24-13-7-11(9-20)6-12(19)8-13/h3,5-8,10H,2,4H2,1H3,(H,22,23)/p-1 |
| InChIKey | WWBYCDACSYGFMH-UHFFFAOYSA-M |
| XLogP | 3.56 |
| TPSA | 90.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|