C20H16F2N2O4S — CID 170565153
3-[[7-(2,2-dimethylaziridin-1-yl)sulfonyl-2-fluoro-1-oxo-2,3-dihydroinden-4-yl]oxy]-5-fluorobenzonitrile (PubChem CID 170565153) has the molecular formula C20H16F2N2O4S and a molecular weight of 418.42 g/mol. Its IUPAC name is 3-[[7-(2,2-dimethylaziridin-1-yl)sulfonyl-2-fluoro-1-oxo-2,3-dihydroinden-4-yl]oxy]-5-fluorobenzonitrile.
| Compound Name | 3-[[7-(2,2-dimethylaziridin-1-yl)sulfonyl-2-fluoro-1-oxo-2,3-dihydroinden-4-yl]oxy]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 170565153 |
| Molecular Formula | C20H16F2N2O4S |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 3-[[7-(2,2-dimethylaziridin-1-yl)sulfonyl-2-fluoro-1-oxo-2,3-dihydroinden-4-yl]oxy]-5-fluorobenzonitrile |
| SMILES | CC1(C)CN1S(=O)(=O)c1ccc(Oc2cc(F)cc(C#N)c2)c2c1C(=O)C(F)C2 |
| InChI | InChI=1S/C20H16F2N2O4S/c1-20(2)10-24(20)29(26,27)17-4-3-16(14-8-15(22)19(25)18(14)17)28-13-6-11(9-23)5-12(21)7-13/h3-7,15H,8,10H2,1-2H3 |
| InChIKey | SMTIKWHPMSFYMZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 87.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|