C19H13F3NO6S- — CID 134519102
[(1R,3S)-3-acetyloxy-7-(3-cyano-5-fluorophenoxy)-2,2-difluoro-1-hydroxy-1,3-dihydroinden-4-yl]methanesulfinate (PubChem CID 134519102) has the molecular formula C19H13F3NO6S- and a molecular weight of 440.38 g/mol. Its IUPAC name is [(1R,3S)-3-acetyloxy-7-(3-cyano-5-fluorophenoxy)-2,2-difluoro-1-hydroxy-1,3-dihydroinden-4-yl]methanesulfinate.
| Compound Name | [(1R,3S)-3-acetyloxy-7-(3-cyano-5-fluorophenoxy)-2,2-difluoro-1-hydroxy-1,3-dihydroinden-4-yl]methanesulfinate |
|---|---|
| PubChem CID | 134519102 |
| Molecular Formula | C19H13F3NO6S- |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | [(1R,3S)-3-acetyloxy-7-(3-cyano-5-fluorophenoxy)-2,2-difluoro-1-hydroxy-1,3-dihydroinden-4-yl]methanesulfinate |
| SMILES | CC(=O)O[C@H]1c2c(CS(=O)[O-])ccc(Oc3cc(F)cc(C#N)c3)c2[C@@H](O)C1(F)F |
| InChI | InChI=1S/C19H14F3NO6S/c1-9(24)28-18-15-11(8-30(26)27)2-3-14(16(15)17(25)19(18,21)22)29-13-5-10(7-23)4-12(20)6-13/h2-6,17-18,25H,8H2,1H3,(H,26,27)/p-1/t17-,18+/m1/s1 |
| InChIKey | MEYQDKBTNIHPAU-MSOLQXFVSA-M |
| XLogP | 3.16 |
| TPSA | 119.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|