C40H27F3O — CID 163803708
2-[3,6-diphenyl-4-(trifluoromethyl)naphthalen-1-yl]-11-methyl-10a,11-dihydronaphtho[2,3-b][1]benzofuran (PubChem CID 163803708) has the molecular formula C40H27F3O and a molecular weight of 580.65 g/mol. Its IUPAC name is 2-[3,6-diphenyl-4-(trifluoromethyl)naphthalen-1-yl]-11-methyl-10a,11-dihydronaphtho[2,3-b][1]benzofuran.
| Compound Name | 2-[3,6-diphenyl-4-(trifluoromethyl)naphthalen-1-yl]-11-methyl-10a,11-dihydronaphtho[2,3-b][1]benzofuran |
|---|---|
| PubChem CID | 163803708 |
| Molecular Formula | C40H27F3O |
| Molecular Weight | 580.65 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | 2-[3,6-diphenyl-4-(trifluoromethyl)naphthalen-1-yl]-11-methyl-10a,11-dihydronaphtho[2,3-b][1]benzofuran |
| SMILES | CC1c2c(oc3ccc(-c4cc(-c5ccccc5)c(C(F)(F)F)c5cc(-c6ccccc6)ccc45)cc23)C=C2C=CC=CC21 |
| InChI | InChI=1S/C40H27F3O/c1-24-30-15-9-8-14-28(30)22-37-38(24)35-21-29(17-19-36(35)44-37)32-23-33(26-12-6-3-7-13-26)39(40(41,42)43)34-20-27(16-18-31(32)34)25-10-4-2-5-11-25/h2-24,30H,1H3 |
| InChIKey | NHEGVYVKDKQGRX-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.65 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |