C50H48O — CID 90262330
2-(4-tert-butylphenyl)-8-(9,10-ditert-butyl-6-phenylanthracen-2-yl)dibenzofuran (PubChem CID 90262330) has the molecular formula C50H48O and a molecular weight of 664.93 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-8-(9,10-ditert-butyl-6-phenylanthracen-2-yl)dibenzofuran.
| Compound Name | 2-(4-tert-butylphenyl)-8-(9,10-ditert-butyl-6-phenylanthracen-2-yl)dibenzofuran |
|---|---|
| PubChem CID | 90262330 |
| Molecular Formula | C50H48O |
| Molecular Weight | 664.93 g/mol |
| Exact Mass | 664.37 |
| IUPAC Name | 2-(4-tert-butylphenyl)-8-(9,10-ditert-butyl-6-phenylanthracen-2-yl)dibenzofuran |
| SMILES | CC(C)(C)c1ccc(-c2ccc3oc4ccc(-c5ccc6c(C(C)(C)C)c7cc(-c8ccccc8)ccc7c(C(C)(C)C)c6c5)cc4c3c2)cc1 |
| InChI | InChI=1S/C50H48O/c1-48(2,3)37-21-15-32(16-22-37)34-19-25-44-40(27-34)41-28-36(20-26-45(41)51-44)35-18-24-39-43(30-35)47(50(7,8)9)38-23-17-33(31-13-11-10-12-14-31)29-42(38)46(39)49(4,5)6/h10-30H,1-9H3 |
| InChIKey | XQGIJOBWXGPPJC-UHFFFAOYSA-N |
| XLogP | 14.79 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.93 |
| LogP ≤ 5 | 14.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|