C34H62O6 — CID 163805696
2-ethylhexyl prop-2-enoate;methyl 2-methylprop-2-enoate;(Z)-octadec-9-enoic acid (PubChem CID 163805696) has the molecular formula C34H62O6 and a molecular weight of 566.86 g/mol. Its IUPAC name is 2-ethylhexyl prop-2-enoate;methyl 2-methylprop-2-enoate;(Z)-octadec-9-enoic acid.
| Compound Name | 2-ethylhexyl prop-2-enoate;methyl 2-methylprop-2-enoate;(Z)-octadec-9-enoic acid |
|---|---|
| PubChem CID | 163805696 |
| Molecular Formula | C34H62O6 |
| Molecular Weight | 566.86 g/mol |
| Exact Mass | 566.45 |
| IUPAC Name | 2-ethylhexyl prop-2-enoate;methyl 2-methylprop-2-enoate;(Z)-octadec-9-enoic acid |
| SMILES | C=C(C)C(=O)OC.C=CC(=O)OCC(CC)CCCC.CCCCCCCC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O2.C11H20O2.C5H8O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-7-8-10(5-2)9-13-11(12)6-3;1-4(2)5(6)7-3/h9-10H,2-8,11-17H2,1H3,(H,19,20);6,10H,3-5,7-9H2,1-2H3;1H2,2-3H3/b10-9-;; |
| InChIKey | NIVOMBOLBQTWJA-XXAVUKJNSA-N |
| XLogP | 9.78 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.86 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|